* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2'-(5-broMo-1,3-phenylene)dipyridine |
CAS: | 150239-89-7 |
English Synonyms: | 2,2'-(5-BROMO-1,3-PHENYLENE)DIPYRIDINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C=C(C=C(C1)C1=NC=CC=C1)C1=NC=CC=C1 |
InChi: | InChI=1S/C16H11BrN2/c17-14-10-12(15-5-1-3-7-18-15)9-13(11-14)16-6-2-4-8-19-16/h1-11H |
InChiKey: | InChIKey=WYBQKTWLOQGECX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.