* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Acetyl-6-azido-L-norleucine |
CAS: | 1505525-07-4 |
English Synonyms: | N-ACETYL-6-AZIDO-L-NORLEUCINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O |
InChi: | InChI=1S/C8H14N4O3/c1-6(13)11-7(8(14)15)4-2-3-5-10-12-9/h7H,2-5H2,1H3,(H,11,13)(H,14,15)/t7-/m0/s1 |
InChiKey: | InChIKey=YVTWABJVKYDHGY-ZETCQYMHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.