* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1,2,3,3-PENTACHLOROPROPANE |
CAS: | 15104-61-7 |
English Synonyms: | 1,1,2,2,3,3-PENTACHLOROPROPANE ; 1,1,2,3,3-PENTACHLOROPROPANE |
MDL Number.: | MFCD00018862 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C(Cl)Cl)(C(Cl)Cl)Cl |
InChi: | InChI=1S/C3H3Cl5/c4-1(2(5)6)3(7)8/h1-3H |
InChiKey: | InChIKey=PANVCEBTPSTUEL-UHFFFAOYSA-N |
Property |
|
Density: | DENSITY: 1.626 TO 1.631 |
Physical Property: | REFRACTIVE INDEX: 1.511 TO 1.513 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.