* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Pyrazol-3-amine, 4-propyl- |
CAS: | 151521-41-4 |
English Synonyms: | 1H-PYRAZOL-3-AMINE, 4-PROPYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CC)C=1C(=NNC1)N |
InChi: | InChI=1S/C6H11N3/c1-2-3-5-4-8-9-6(5)7/h4H,2-3H2,1H3,(H3,7,8,9) |
InChiKey: | InChIKey=PLIAITMRGNSLTO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.