* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACOLBIFENE |
CAS: | 151533-34-5 ;252555-01-4 |
English Synonyms: | ACOLBIFENE |
MDL Number.: | MFCD09837712 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC1=C([C@@H](Oc2c1ccc(c2)O)c3ccc(cc3)OCCN4CCCCC4)c5ccc(cc5)O |
InChi: | InChI=1S/C29H31NO4/c1-20-26-14-11-24(32)19-27(26)34-29(28(20)21-5-9-23(31)10-6-21)22-7-12-25(13-8-22)33-18-17-30-15-3-2-4-16-30/h5-14,19,29,31-32H,2-4,15-18H2,1H3/t29-/m0/s1 |
InChiKey: | InChIKey=DUYNJNWVGIWJRI-LJAQVGFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.