* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (+)-N-FLUORO-2,10-(3,3-DICHLOROCAMPHORSULTAM) |
CAS: | 151556-58-0 |
English Synonyms: | (+)-N-FLUORO-2,10-(3,3-DICHLOROCAMPHORSULTAM) |
MDL Number.: | MFCD16876410 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1([C@@H]2CC[C@]13CS(=O)(=O)N([C@H]3C2(Cl)Cl)F)C |
InChi: | InChI=1S/C10H14Cl2FNO2S/c1-8(2)6-3-4-9(8)5-17(15,16)14(13)7(9)10(6,11)12/h6-7H,3-5H2,1-2H3/t6-,7+,9+/m0/s1 |
InChiKey: | InChIKey=KYKGOCRIELYYGD-LKEWCRSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.