* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Methyl 2-(6-bromo-1H-indol-3-yl)acetate |
CAS: | 152213-63-3 |
English Synonyms: | METHYL 2-(6-BROMO-1H-INDOL-3-YL)ACETATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C2C(=CNC2=C1)CC(=O)OC |
InChi: | InChI=1S/C11H10BrNO2/c1-15-11(14)4-7-6-13-10-5-8(12)2-3-9(7)10/h2-3,5-6,13H,4H2,1H3 |
InChiKey: | InChIKey=BMFSVEXJEHZDHD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.