* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CGP-53716 |
CAS: | 152459-94-4 |
English Synonyms: | CGP-53716 |
MDL Number.: | MFCD00945675 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)NC(=O)c4ccccc4 |
InChi: | InChI=1S/C23H19N5O/c1-16-9-10-19(26-22(29)17-6-3-2-4-7-17)14-21(16)28-23-25-13-11-20(27-23)18-8-5-12-24-15-18/h2-15H,1H3,(H,26,29)(H,25,27,28) |
InChiKey: | InChIKey=UOEJSOXEHKCNAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.