Molecular Structure:
CAS No.:
15291-78-8
Product Name.:
CCD No.:CCD00711282
Formula:C20 H24 O10
MolWeight:424.4
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(7)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | GINKGOLIDEM |
| CAS： | 15291-78-8 |
| English Synonyms： | GINKGOLIDEM |
| MDL Number.： | MFCD09038732 |
| H bond acceptor： | 10 |
| H bond donor： | 3 |
| Smile： | C[C@H]1[C@H]2[C@H]([C@H](C34[C@]25C(=O)O[C@@H]3[C@@H]([C@H]([C@@]46[C@H](C(=O)O[C@H]6O5)O)C(C)(C)C)O)O)OC1=O |
| InChi： | InChI=1S/C20H24O10/c1-5-6-8(27-13(5)24)10(22)19-12-7(21)9(17(2,3)4)18(19)11(23)14(25)29-16(18)30-20(6,19)15(26)28-12/h5-12,16,21-23H,1-4H3/t5-,6-,7+,8+,9-,10+,11-,12+,16-,18-,19?,20+/m0/s1 |
| InChiKey： | InChIKey=KDKROYXEHCYLJQ-OAUBMDPJSA-N |
|
|
| Comments： | ASSAY BY HPLC |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
