Molecular Structure:
CAS No.:
153034-99-2
Product Name.:
CCD No.:CCD00860193
Formula:C5 H2 Cl F I N
MolWeight:257.429
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(8)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 2-CHLORO-3-FLUORO-5-IODOPYRIDINE |
| CAS： | 153034-99-2 |
| English Synonyms： | ABBYPHARMA AP-30-7483 ; 2-CHLORO-3-FLUORO-5-IODOPYRIDINE |
| MDL Number.： | MFCD09909856 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1c(cnc(c1F)Cl)I |
| InChi： | InChI=1S/C5H2ClFIN/c6-5-4(7)1-3(8)2-9-5/h1-2H |
| InChiKey： | InChIKey=AQWFITTVERKBNT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
