* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRANS-4,5,5A,6,7,8,9,9A-OCTAHYDROTHIAZOLO(4,5-F)QUINOLIN-2-AMINE |
CAS: | 153260-24-3 |
English Synonyms: | TRANS-4,5,5A,6,7,8,9,9A-OCTAHYDROTHIAZOLO(4,5-F)QUINOLIN-2-AMINE |
MDL Number.: | MFCD02752387 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1C[C@@H]2c3c(sc(n3)N)CC[C@H]2NC1 |
InChi: | InChI=1S/C10H15N3S/c11-10-13-9-6-2-1-5-12-7(6)3-4-8(9)14-10/h6-7,12H,1-5H2,(H2,11,13)/t6-,7+/m0/s1 |
InChiKey: | InChIKey=BAHUCMQZRKBOSK-NKWVEPMBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.