* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VERANISATIN B |
CAS: | 153445-93-3 |
English Synonyms: | VERANISATIN B |
MDL Number.: | MFCD01760063 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | C[C@@H]1CC[C@]2([C@@]13C[C@@H]([C@]([C@@]24COC4=O)(C(=O)OC)O)OC(=O)[C@@H]3O)O |
InChi: | InChI=1S/C16H20O9/c1-7-3-4-15(21)13(7)5-8(25-10(18)9(13)17)16(22,12(20)23-2)14(15)6-24-11(14)19/h7-9,17,21-22H,3-6H2,1-2H3/t7-,8+,9+,13+,14-,15-,16-/m1/s1 |
InChiKey: | InChIKey=BPDHZCGFGOWILW-QTSFMTSUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.