* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,7-/2,3,8-TRIMETHYLDIBENZOTHIOPHENE |
CAS: | 212332-91-7 ;153524-16-4 |
English Synonyms: | 2,3,7-/2,3,8-TRIMETHYLDIBENZOTHIOPHENE |
MDL Number.: | MFCD02683735 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)c3cc(c(cc3s2)C)C.Cc1ccc2c3cc(c(cc3sc2c1)C)C |
InChi: | InChI=1S/2C15H14S/c1-9-4-5-14-12(6-9)13-7-10(2)11(3)8-15(13)16-14;1-9-4-5-12-13-7-10(2)11(3)8-15(13)16-14(12)6-9/h2*4-8H,1-3H3 |
InChiKey: | InChIKey=CXNZRLFEMCADSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.