* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRANO[4,3-B]PYRROL-6(1H)-ONE |
CAS: | 153602-63-2 |
English Synonyms: | PYRANO[4,3-B]PYRROL-6(1H)-ONE |
MDL Number.: | MFCD12923565 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c[nH]c2c1coc(=O)c2 |
InChi: | InChI=1S/C7H5NO2/c9-7-3-6-5(4-10-7)1-2-8-6/h1-4,8H |
InChiKey: | InChIKey=SKKPRWRKVOSHRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.