* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Indole, 5-(2-propyn-1-yloxy)- |
CAS: | 153969-91-6 |
English Synonyms: | 1H-INDOLE, 5-(2-PROPYN-1-YLOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C#C)OC=1C=C2C=CNC2=CC1 |
InChi: | InChI=1S/C11H9NO/c1-2-7-13-10-3-4-11-9(8-10)5-6-12-11/h1,3-6,8,12H,7H2 |
InChiKey: | InChIKey=UOMBOZOHHCAYNA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.