* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Pentynamide, 2-amino-N-methyl- |
CAS: | 1544176-51-3 |
English Synonyms: | 4-PENTYNAMIDE, 2-AMINO-N-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC(C(=O)NC)CC#C |
InChi: | InChI=1S/C6H10N2O/c1-3-4-5(7)6(9)8-2/h1,5H,4,7H2,2H3,(H,8,9) |
InChiKey: | InChIKey=YSMNLUQHSPHFBL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.