* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7,(5ALPHA)-CHOLESTEN-3-ONE |
CAS: | 15459-85-5 |
English Synonyms: | 7,(5ALPHA)-CHOLESTEN-3-ONE |
MDL Number.: | MFCD00201502 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CCC(=O)C4)C)C |
InChi: | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h10,18-20,23-25H,6-9,11-17H2,1-5H3/t19-,20+,23-,24+,25+,26+,27-/m1/s1 |
InChiKey: | InChIKey=FLRPNSKUGCVRRB-IINKENNYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.