* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Cycloheptane, (3-iodophenoxy)- |
CAS: | 1546931-18-3 |
English Synonyms: | CYCLOHEPTANE, (3-IODOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | IC=1C=C(OC2CCCCCC2)C=CC1 |
InChi: | InChI=1S/C13H17IO/c14-11-6-5-9-13(10-11)15-12-7-3-1-2-4-8-12/h5-6,9-10,12H,1-4,7-8H2 |
InChiKey: | InChIKey=VGOLAPTYPFDLRB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.