* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Butanoic acid, 4-[(2-bromophenyl)methoxy]- |
CAS: | 1548231-34-0 |
English Synonyms: | BUTANOIC ACID, 4-[(2-BROMOPHENYL)METHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=C(C=CC=C1)COCCCC(=O)O |
InChi: | InChI=1S/C11H13BrO3/c12-10-5-2-1-4-9(10)8-15-7-3-6-11(13)14/h1-2,4-5H,3,6-8H2,(H,13,14) |
InChiKey: | InChIKey=YPRQAJRYMONZMT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.