* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Cycloheptane, (2-bromophenoxy)- |
CAS: | 1548394-71-3 |
English Synonyms: | CYCLOHEPTANE, (2-BROMOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=C(OC2CCCCCC2)C=CC=C1 |
InChi: | InChI=1S/C13H17BrO/c14-12-9-5-6-10-13(12)15-11-7-3-1-2-4-8-11/h5-6,9-11H,1-4,7-8H2 |
InChiKey: | InChIKey=OCZUQFQAWSGISG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.