* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Octanoic acid, 8-(3-aminophenoxy)- |
CAS: | 155148-06-4 |
English Synonyms: | OCTANOIC ACID, 8-(3-AMINOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC=1C=C(OCCCCCCCC(=O)O)C=CC1 |
InChi: | InChI=1S/C14H21NO3/c15-12-7-6-8-13(11-12)18-10-5-3-1-2-4-9-14(16)17/h6-8,11H,1-5,9-10,15H2,(H,16,17) |
InChiKey: | InChIKey=SCOOWCCKZQEBNG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.