* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INOGATRAN |
CAS: | 155415-08-0 |
English Synonyms: | INOGATRAN |
MDL Number.: | MFCD00921988 |
H bond acceptor: | 10 |
H bond donor: | 6 |
Smile: | C1CCC(CC1)C[C@H](C(=O)N2CCCC[C@H]2C(=O)NCCCNC(=N)N)NCC(=O)O |
InChi: | InChI=1S/C21H38N6O4/c22-21(23)25-11-6-10-24-19(30)17-9-4-5-12-27(17)20(31)16(26-14-18(28)29)13-15-7-2-1-3-8-15/h15-17,26H,1-14H2,(H,24,30)(H,28,29)(H4,22,23,25)/t16-,17+/m1/s1 |
InChiKey: | InChIKey=CDPROXZBMHOBTQ-SJORKVTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.