* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BENZYL-1,3-DIMETHYL-8-NITRO-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| CAS: | 155581-78-5 |
| English Synonyms: | 7-BENZYL-1,3-DIMETHYL-8-NITRO-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD02049363 |
| H bond acceptor: | 9 |
| H bond donor: | 0 |
| Smile: | Cn1c2c(c(=O)n(c1=O)C)n(c(n2)[N+](=O)[O-])Cc3ccccc3 |
| InChi: | InChI=1S/C14H13N5O4/c1-16-11-10(12(20)17(2)14(16)21)18(13(15-11)19(22)23)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChiKey: | InChIKey=QXODFOCFKAUFBE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.