* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IR-1100 |
CAS: | 155614-03-2 |
English Synonyms: | IR-1100 |
MDL Number.: | MFCD00192039 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | [B-](F)(F)(F)F.c1ccc(cc1)C2=CC(=[O+]C\3C2CCC/C3=C\C4=C(/C(=C/C5=C6C(=C(C=C(O6)c7ccccc7)c8ccccc8)CCC5)/CCC4)c9ccccc9)c1ccccc1 |
InChi: | InChI=1S/C56H49O2.BF4/c1-6-19-39(20-7-1)50-37-52(41-23-10-3-11-24-41)57-55-46(31-17-33-48(50)55)35-44-29-16-30-45(54(44)43-27-14-5-15-28-43)36-47-32-18-34-49-51(40-21-8-2-9-22-40)38-53(58-56(47)49)42-25-12-4-13-26-42;2-1(3,4)5/h1-15,19-28,35-38,48,55H,16-18,29-34H2;/q+1;-1/b45-36+,46-35+; |
InChiKey: | InChIKey=DHJQTLKHWRSDIN-NDUIXFCASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.