* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 1-(cyclopentyloxy)-2-iodo- |
CAS: | 156575-16-5 |
English Synonyms: | BENZENE, 1-(CYCLOPENTYLOXY)-2-IODO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(CCCC1)OC1=C(C=CC=C1)I |
InChi: | InChI=1S/C11H13IO/c12-10-7-3-4-8-11(10)13-9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2 |
InChiKey: | InChIKey=LWFOHWGWHJHQEZ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.