* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-(-)-6-METHYL-5-HEPTEN-2-OL |
CAS: | 58917-27-4 ;1569-60-4 |
English Synonyms: | (2R)-6-METHYLHEPT-5-EN-2-OL ; (2R)-6-METHYL-5-HEPTEN-2-OL ; (R)-(-)-6-METHYL-5-HEPTEN-2-OL |
MDL Number.: | MFCD03093079 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C[C@H](CCC=C(C)C)O |
InChi: | InChI=1S/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3/t8-/m1/s1 |
InChiKey: | InChIKey=OHEFFKYYKJVVOX-MRVPVSSYSA-N |
Property |
|
Boiling Point: | 78-80 DEG C/15MM |
Density: | DENSITY: 0.844 |
Physical Property: | FLASHPOINT: 67 DEG C(152 DEG F) REFRACTIVE INDEX: 1.4480 |
Comments: | BRN: 1720072 OPTICAL ROTATION: -18 DEG (NEAT) TSCA: N UNSPSC: 12352104 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.