* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-bis(2,4,6-trimethylphenyl)-3,4,5,6-tetrahydro-2(1H)-pyrimidinethione |
CAS: | 1569099-99-5 |
English Synonyms: | 1,3-BIS(2,4,6-TRIMETHYLPHENYL)-3,4,5,6-TETRAHYDRO-2(1H)-PYRIMIDINETHIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=C(C(=CC(=C1)C)C)N1C(N(CCC1)C1=C(C=C(C=C1C)C)C)=S |
InChi: | InChI=1S/C22H28N2S/c1-14-10-16(3)20(17(4)11-14)23-8-7-9-24(22(23)25)21-18(5)12-15(2)13-19(21)6/h10-13H,7-9H2,1-6H3 |
InChiKey: | InChIKey=BPPACTBMDHVLEC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.