* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | O-(3-Bromopropyl)-L-tyrosine HCl |
CAS: | 1579942-17-8 |
English Synonyms: | O-(3-BROMOPROPYL)-L-TYROSINE HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.BrCCCOC1=CC=C(C[C@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C12H16BrNO3.ClH/c13-6-1-7-17-10-4-2-9(3-5-10)8-11(14)12(15)16;/h2-5,11H,1,6-8,14H2,(H,15,16);1H/t11-;/m0./s1 |
InChiKey: | InChIKey=LYEOBZJDPIFVIK-MERQFXBCSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.