* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | O-(4-Bromobutyl)-L-tyrosine HCl |
CAS: | 1579942-19-0 |
English Synonyms: | O-(4-BROMOBUTYL)-L-TYROSINE HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.BrCCCCOC1=CC=C(C[C@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C13H18BrNO3.ClH/c14-7-1-2-8-18-11-5-3-10(4-6-11)9-12(15)13(16)17;/h3-6,12H,1-2,7-9,15H2,(H,16,17);1H/t12-;/m0./s1 |
InChiKey: | InChIKey=YEKMSQXWRXEHEO-YDALLXLXSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.