* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Propanoic acid, 3-[2-(aminooxy)ethoxy]- |
CAS: | 1591849-14-7 |
English Synonyms: | PROPANOIC ACID, 3-[2-(AMINOOXY)ETHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NOCCOCCC(=O)O |
InChi: | InChI=1S/C5H11NO4/c6-10-4-3-9-2-1-5(7)8/h1-4,6H2,(H,7,8) |
InChiKey: | InChIKey=GFTKTVMFVCHBHR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.