* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-Norleucine, 6-azido- |
CAS: | 159610-92-1 |
English Synonyms: | L-NORLEUCINE, 6-AZIDO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCC[C@H](N)C(=O)O |
InChi: | InChI=1S/C6H12N4O2/c7-5(6(11)12)3-1-2-4-9-10-8/h5H,1-4,7H2,(H,11,12)/t5-/m0/s1 |
InChiKey: | InChIKey=HTFFMYRVHHNNBE-YFKPBYRVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.