* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (Z)-3-BROMOACRYLIC ACID |
| CAS: | 1609-92-3 |
| English Synonyms: | (Z)-3-BROMOACRYLIC ACID |
| MDL Number.: | MFCD00075363 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C(=C\Br)\C(=O)O |
| InChi: | InChI=1S/C3H3BrO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/b2-1- |
| InChiKey: | InChIKey=POAWTYXNXPEWCO-UPHRSURJSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.