* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 1-(4-bromobutyl)-2,4-dimethoxy- |
CAS: | 160911-09-1 |
English Synonyms: | BENZENE, 1-(4-BROMOBUTYL)-2,4-DIMETHOXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCC1=C(C=C(C=C1)OC)OC |
InChi: | InChI=1S/C12H17BrO2/c1-14-11-7-6-10(5-3-4-8-13)12(9-11)15-2/h6-7,9H,3-5,8H2,1-2H3 |
InChiKey: | InChIKey=FWUNKBZDWIVAFY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.