* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-ETHYL-1,2,4-TRIAZIN-5(2H)-ONE |
CAS: | 16120-04-0 |
English Synonyms: | 6-ETHYL-1,2,4-TRIAZIN-5(2H)-ONE ; 6-ETHYL-2,5-DIHYDRO-1,2,4-TRIAZIN-5-ONE |
MDL Number.: | MFCD17012822 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1c(=O)nc[nH]n1 |
InChi: | InChI=1S/C5H7N3O/c1-2-4-5(9)6-3-7-8-4/h3H,2H2,1H3,(H,6,7,9) |
InChiKey: | InChIKey=UUFGUJLCGMTUHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.