* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,4a,5,6,7-Octahydronaphthalene-2,7-dione |
CAS: | 1614-81-9 |
English Synonyms: | 1,2,3,4,4A,5,6,7-OCTAHYDRONAPHTHALENE-2,7-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1C(CCC2CCC(C=C12)=O)=O |
InChi: | InChI=1S/C10H12O2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h5,7H,1-4,6H2 |
InChiKey: | InChIKey=UHYDPRVNGWADCJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.