* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 1-[(8-bromooctyl)oxy]-2-methyl- |
CAS: | 1621344-12-4 |
English Synonyms: | BENZENE, 1-[(8-BROMOOCTYL)OXY]-2-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCCCCCOC1=C(C=CC=C1)C |
InChi: | InChI=1S/C15H23BrO/c1-14-10-6-7-11-15(14)17-13-9-5-3-2-4-8-12-16/h6-7,10-11H,2-5,8-9,12-13H2,1H3 |
InChiKey: | InChIKey=BDNTYHQCUWXOSG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.