* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3(2H)-Isoquinolinone, 1,4-dihydro-2-propyl- |
CAS: | 162334-79-4 |
English Synonyms: | 3(2H)-ISOQUINOLINONE, 1,4-DIHYDRO-2-PROPYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CC)N1CC2=CC=CC=C2CC1=O |
InChi: | InChI=1S/C12H15NO/c1-2-7-13-9-11-6-4-3-5-10(11)8-12(13)14/h3-6H,2,7-9H2,1H3 |
InChiKey: | InChIKey=ZUSMRSCBGXALDA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.