* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YUNNANCORONARIN A |
| CAS: | 162762-93-8 |
| English Synonyms: | YUNNANCORONARIN A |
| MDL Number.: | MFCD17214878 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1(CCC[C@]2([C@H]1[C@@H](CC(=C)[C@@H]2/C=C/c3ccoc3)O)C)C |
| InChi: | InChI=1S/C20H28O2/c1-14-12-17(21)18-19(2,3)9-5-10-20(18,4)16(14)7-6-15-8-11-22-13-15/h6-8,11,13,16-18,21H,1,5,9-10,12H2,2-4H3/b7-6+/t16-,17+,18-,20+/m0/s1 |
| InChiKey: | InChIKey=UTIGHTZWXIGRIJ-JEQJTPLUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.