* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODO-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-YLAMINE |
| CAS: | 162791-77-7 |
| English Synonyms: | 8-IODO-PYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-YLAMINE ; 8-IODOPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4-AMINE |
| MDL Number.: | MFCD18073975 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1c(c2ncnc(n2n1)N)I |
| InChi: | InChI=1S/C5H4IN5/c6-3-1-10-11-4(3)8-2-9-5(11)7/h1-2H,(H2,7,8,9) |
| InChiKey: | InChIKey=BTGHVDMQZMXGGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.