* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-GLY-LEU-GLY-OH |
CAS: | 16295-38-8 |
English Synonyms: | Z-GLY-LEU-GLY-OH |
MDL Number.: | MFCD00238458 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)CNC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C18H25N3O6/c1-12(2)8-14(17(25)19-10-16(23)24)21-15(22)9-20-18(26)27-11-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3,(H,19,25)(H,20,26)(H,21,22)(H,23,24)/t14-/m0/s1 |
InChiKey: | InChIKey=CBLYMECSQPXYHQ-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.