* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 1-(cyclobutyloxy)-3-iodo- |
CAS: | 1643457-27-5 |
English Synonyms: | BENZENE, 1-(CYCLOBUTYLOXY)-3-IODO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(CCC1)OC1=CC(=CC=C1)I |
InChi: | InChI=1S/C10H11IO/c11-8-3-1-6-10(7-8)12-9-4-2-5-9/h1,3,6-7,9H,2,4-5H2 |
InChiKey: | InChIKey=UDXPNYBOOYNFNJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.