* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PHENYL-1-INDANONE |
CAS: | 16619-12-8 |
English Synonyms: | 2-PHENYL-2,3-DIHYDRO-1H-INDEN-1-ONE ; 2-PHENYL-1-INDANONE |
MDL Number.: | MFCD02685564 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2Cc3ccccc3C2=O |
InChi: | InChI=1S/C15H12O/c16-15-13-9-5-4-8-12(13)10-14(15)11-6-2-1-3-7-11/h1-9,14H,10H2 |
InChiKey: | InChIKey=OCLCRYNZYRSURW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.