* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-AMINO-4-METHYL-4H-1,2,4-TRIAZOLE |
CAS: | 16681-76-8 |
English Synonyms: | 3-AMINO-4-METHYL-4H-1,2,4-TRIAZOLE ; 4-METHYL-4H-1,2,4-TRIAZOL-3-AMINE |
MDL Number.: | MFCD02666159 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cnnc1N |
InChi: | InChI=1S/C3H6N4/c1-7-2-5-6-3(7)4/h2H,1H3,(H2,4,6) |
InChiKey: | InChIKey=UQUDZKOREXYFDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.