* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC PICRATE X-HYDRATE |
| CAS: | 16824-81-0 |
| English Synonyms: | ZINC PICRATE X-HYDRATE |
| MDL Number.: | MFCD00167196 |
| H bond acceptor: | 20 |
| H bond donor: | 0 |
| Smile: | c1c(cc(c(c1[N+](=O)[O-])O[Zn]Oc2c(cc(cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-].O |
| InChi: | InChI=1S/2C6H3N3O7.H2O.Zn/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;/h2*1-2,10H;1H2;/q;;;+2/p-2 |
| InChiKey: | InChIKey=XYVMIUVWRVIYHN-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.