* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3,5,7-TETRAMETHYLADAMANTANE |
| CAS: | 1687-36-1 |
| English Synonyms: | 1,3,5,7-TETRAMETHYLADAMANTANE |
| MDL Number.: | MFCD02702715 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C[C@]12C[C@@]3(C[C@](C1)(C[C@](C2)(C3)C)C)C |
| InChi: | InChI=1S/C14H24/c1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12/h5-10H2,1-4H3/t11-,12+,13-,14+ |
| InChiKey: | InChIKey=UJSORZVCMMYGBS-KPWCQOOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.