* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,5,8,11-TETRAMETHYL-6-DODECYN-5,8-DIOL ETHOXYLATE |
CAS: | 169117-72-0 |
English Synonyms: | 2,5,8,11-TETRAMETHYL-6-DODECYN-5,8-DIOL ETHOXYLATE |
MDL Number.: | MFCD06798940 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOC(C)(CCC(C)C)C#CC(C)(CCC(C)C)OCC |
InChi: | InChI=1S/C20H38O2/c1-9-21-19(7,13-11-17(3)4)15-16-20(8,22-10-2)14-12-18(5)6/h17-18H,9-14H2,1-8H3 |
InChiKey: | InChIKey=GCZDIJZDAHHPDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.