* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-HYDRAZINO-6-METHYL-1,2,4-TRIAZIN-3(2H)-ONE |
CAS: | 16946-87-5 |
English Synonyms: | 5-HYDRAZINO-6-METHYL-1,2,4-TRIAZIN-3(2H)-ONE ; 5-HYDRAZINYL-6-METHYL-2,3-DIHYDRO-1,2,4-TRIAZIN-3-ONE |
MDL Number.: | MFCD02977577 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1c(nc(=O)[nH]n1)NN |
InChi: | InChI=1S/C4H7N5O/c1-2-3(7-5)6-4(10)9-8-2/h5H2,1H3,(H2,6,7,9,10) |
InChiKey: | InChIKey=DLRWFYQEPZGOGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.