* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Boc-3-azetidinebutanoic acid |
CAS: | 1697321-54-2 |
English Synonyms: | 1-BOC-3-AZETIDINEBUTANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N1CC(C1)CCCC(=O)O |
InChi: | InChI=1S/C12H21NO4/c1-12(2,3)17-11(16)13-7-9(8-13)5-4-6-10(14)15/h9H,4-8H2,1-3H3,(H,14,15) |
InChiKey: | InChIKey=KSKBTIBSNQGTKO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.