* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-LYS-LEU-OH |
CAS: | 169765-38-2 |
English Synonyms: | Z-LYS-LEU-OH |
MDL Number.: | MFCD00238482 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C20H31N3O5/c1-14(2)12-17(19(25)26)22-18(24)16(10-6-7-11-21)23-20(27)28-13-15-8-4-3-5-9-15/h3-5,8-9,14,16-17H,6-7,10-13,21H2,1-2H3,(H,22,24)(H,23,27)(H,25,26)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=JZJZOALIBGETEW-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.