* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Hexanol, 6-(3-ethylphenoxy)- |
CAS: | 1699273-79-4 |
English Synonyms: | 1-HEXANOL, 6-(3-ETHYLPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)C=1C=C(OCCCCCCO)C=CC1 |
InChi: | InChI=1S/C14H22O2/c1-2-13-8-7-9-14(12-13)16-11-6-4-3-5-10-15/h7-9,12,15H,2-6,10-11H2,1H3 |
InChiKey: | InChIKey=GZSYCIMQEYWINI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.